ГДЗ (ответы) к рабочей тетради Химия 8 класc Габриелян О.С. Генетическая связь между классами неорганических соединений
Красным цветом даются ответыа фиолетовым ― объяснения.
ЧАСТЬ I
Вопрос 1
Генетическая связь – это связь между веществами разных классов, основанная на их взаимопревращениях.

Вопрос 2
а) Li ⟶ X ⟶ LiOH ⟶ LiCl ⟶ LiNO3
Название и формула вещества, обозначенного X: оксид лития Li2O.
Уравнения реакций, соответствующих приведённым выше превращениям:
1) 4Li + O2 = 2Li2O
2) Li2O + H2O = 2LiOH
3) LiOH + HCl = LiCl + H2O
4) LiCl + AgNO3 = LiNO3 + AgCl↓
5) Li2O + 2HCl = 2LiCl + H2O
6) 2Li + 2H2O = 2LiOH + H2
7) LiOH + HNO3 = LiNO3 + H2O

б) Cu ⟶ X ⟶ CuSO4 ⟶ Y ⟶ CuSO4 ⟶ Y ⟶ X ⟶ Cu
Названия и формулы веществ, обозначенных X и Y: оксид меди (II) CuO, гидроксид меди (II) Cu(OH)2.
Уравнения реакций, соответствующих приведенным выше превращениям:
1) 2Cu + O2 = 2CuO
2) CuO + H2SO4 = CuSO4 + H2O
3) CuSO4 + 2NaOH = Na2SO4 + Cu(OH)2
4) Cu(OH)2 + H2SO4 = CuSO4 + 2H2O
5) CuSO4 + 2KOH = K2SO4 + Cu(OH)2
6) Cu(OH)2 = CuO + H2O    (при t0C)
7) CuO + H2 = Cu + H2O

Вопрос 3
Генетический ряд неметалла объединяет:
один и тот же элемент-неметалл;
вещества разных классов, образованные этим неметаллом;
взаимопревращения веществ ряда.
а) S ⟶ X ⟶ H2SO3 ⟶ Na2SO3 ⟶ X
Название и формула вещества, обозначенного X: оксид серы (IV) SO2.
Уравнения реакций, соответствующих приведённым выше превращениям:
1) S + O2 = SO2
2) SO2 + H2O ⇄ H2SO3
3) H2SO3 + 2NaOH = Na2SO3 + 2H2O
4) Na2SO3 + 2HCl = 2NaCl + H2O + SO2

б) Si 1⟶ X 2⟶ Na2SiO3 3⟶ H2SiO3 4⟶ Y 5⟶ X 6⟶ Si
Название и формула вещества, обозначенного X: оксид кремния (IV) SiOи вода Н2О
Уравнения реакций, соответствующих приведённым выше превращениям:
1) Si + O2 = SiO2
2) SiO2 + 2NaOH = Na2SiO3 + H2O
3) Na2SO3 + 2HCl = 2NaCl + H2SiO3
4) H2SiO3 = SiO2 + H2O  (t0C)
5) 
6) SiO2 + C = CO2 + Si
ЧАСТЬ II
Задание 1
В схеме превращений SO2X₁⟶ SO3X₂⟶ H2SO4X₃⟶ Na2SO4 веществами X1, X2 и X3 являются соответственно:
1) O2, H2O, NaOH
2) NO2, H2, NaCl
3) O2, H2O, N2
4) O2, H2, NH3•H2O
Запишите уравнения реакций, соответствующих приведённым выше превращениям:
1) 2SO2 + O2 ⇄ 2SO3
2) SO3 + H2O = H2SO4
3) H2SO4 + 2NaOH = Na2SO4 + 2H2O
Генетический ряд какого химического элемента предложен в этом задании? Серы S.

Задание 2
В схеме превращений S ⟶ X1 ⟶ SO3 ⟶ X2 ⟶ CuSO4 ⟶ X3 ⟶ CuO ⟶ Cu веществами X1, X2 и X3 являются соответственно:
1) H2S, H2SO4, Cu(OH)2
2) FeS, H2SO4, Cu(OH)2
3) SO2, H2SO4, N2
4) SO2, H2SO4, Cu(OH)2
Уравнения реакций, соответствующих приведённым выше превращениям:
1) S + O2 = SO2
2) 2SO2 + O2 ⇄ 2SO3
3) SO3 + H2O = H2SO4
4) H2SO4 + CuO = CuSO4 + H2O
5) CuSO4 + 2NaOH = Na2SO4 + Cu(OH)2
6) Cu(OH)2 = CuO + H2O  (t0C)
7) CuO + H2 = Cu + H2O  (t0C)
Генетические ряды каких химических элементов предложены в этом задании? Серы S и меди Cu.

Задание 3 
В цепочке превращений Ca ⟶ X1 ⟶ Ca(OH)2 ⟶ X2 ⟶ CaO ⟶ X3 ⟶ AgCl веществами X1, X2 и X3 являются соответственно:
1) CaO, CaCO3, CaCl2
2) CaSO4, CaCO3, CaCl2
3) CaO, CaSO4, CaCl2
4) CaO, Ca(HCO3)2, CaCO3
Уравнения реакций, соответствующих приведённым выше превращениям:
1) 2Ca + O2 = 2CaO
2) CaO + H2O = Ca(OH)2
3) Ca(OH)2 + CO2 = CaCO3↓ + H2O
4) CaCO3 = CaO + CO2↑   (t0C)
5) CaO + 2HCl = CaCl2 + H2O
6) CaCl2 + 2AgNO3 = Ca(NO3)2 + 2AgCl↓
Какое соединение выпадает из общего генетического ряда? Хлорид серебра (I) AgCl

Задание 4
К раствору гидроксида натрия добавили неизвестный раствор голубого цвета. Выпал студенистый осадок ярко-синего цвета. При нагревании последнего цвет изменился на чёрный. К полученной смеси прилили раствор серной кислоты. При нагревании исследуемой смеси образовался прозрачный раствор исходного голубого цвета. Запишите уравнения превращений в молекулярной и ионной формах.
1) 2NaOH + CuSO4 = Na2SO4 + Cu(OH)2
   2Na+ + 2OH- + Cu2+ + SO42- = 2Na+ + SO42- + Cu(OH)2
   Cu2+ + 2OH- = Cu(OH)2

2) Сu(OH)2 = CuO + H2O  (t0C)
3) CuO + H2SO4 = CuSO4 + H2O
   CuO + 2H+ + SO42- = Cu2+ + SO42- + H2O
   CuO + 2H+ = Cu2+ + H2O


Задание 5
Вычислите массу осадка, который выпадает при сливании 807 г 20%-го раствора нитрата свинца с раствором, содержащим необходимое количество иодида калия. Определите количество иодида калия.
Дано: ω(Pb(NO3)2)=20%, m(раствора)=807 г
Найти: m(PbI2)-?, n(KI)-?
Решение

1-й способ
1. Вычисляем массу нитрата свинца в растворе:
m(Pb(NO3)2)=m(раствора)•ω(Pb(NO3)2):100%=807 г • 20% : 100%=161,4 г
2. Вычисляем количество вещества нитрата свинца массой 161,4 г по формуле: n=m/M, где M ― молярная масса.
Mr
(Pb(NO3)2)=Ar(Pb)+2•Ar(N)+6•Ar(O)=207+2•14+6•16=331, поэтому M(Pb(NO3)2)=331 г/моль

n(Pb(NO3)2)=m(Pb(NO3)2)/M(Pb(NO3)2)=161,4 г : 331 г/моль=0,488 моль
3. Запишем уравнению реакции:
Pb(NO3)2 + 2KI = 2KNO3 + PbI2
По уравнению реакции n(Pb(NO3)2):n(KI):n(PbI2)=1:2:1, количество вещества нитрата свинца и осадка иодида свинца одинаковое, а количество вещества иодида калия в 2 раза больше количества вещества нитрата свинца, поэтому
n(PbI2)=n(Pb(NO3)2)=0,488 моль
n(KI)=n(Pb(NO3)2)•2=0,488 моль•2=0,98 моль

4. Вычисляем массу иодида свинца количеством вещества 0,488 моль по формуле: m=n•M, где M  молярная масса.
Mr(PbI2)=Ar(Pb)+2Ar(I)=208+2127=462, поэтому M(PbI2)=462 г/моль
m(PbI2)=n(PbI2)•M(PbI2)=0,488 моль • 462 г/моль=225 г

2-й способ
1. Вычисляем массу нитрата свинца в растворе:
m(Pb(NO3)2)=m(раствора)•ω(Pb(NO3)2):100%=807 г • 20% : 100%=161,4 г
2. Составим химическое уравнение:
161,4 г       х моль                у г
Pb(NO3)2 + 2KI = 2KNO3 + PbI2
331 г         2 моль                462 г

Над формулами соединений Pb(NO3)2, KI и PbI2 записываем вычисленную массу соли (161,4 г), неизвестное количество вещества и неизвестную массу соли (х моль и у г соответственно), а под формулами соединений ― количество вещества и массу соответствующего количества вещества согласно коэффициентам в химическом уравнении. Для этого вычисляем молярную массу солей и, соответственно, массу 1 моль, так как прореагировало 1 моль нитрата свинца Pb(NO3)2 с 2 моль иодида калия KI с образованием 1 моль иодида свинца PbI2.
Mr(Pb(NO3)2)=Ar(Pb)+2•Ar(N)+6•Ar(O)=207+2•14+6•16=331, поэтому M(Pb(NO3)2)=331 г/моль, масса 1 моль=331 г.
Mr(PbI2)=Ar(Pb)+2•Ar(I)=208+2•127=462, поэтому M(PbI2)=462 г/моль, масса 1 моль=462 г
3. Количество вещества иодида калия рассчитываем с помощью пропорции:
161,4 г / 331 г = х моль / 2 моль, отсюда по свойству пропорции имеем: х моль • 331 г = 161,4 г • 2 моль
х=n(KI)=161,4 г • 2 моль : 331 г = 0,98 моль
4. Массу иодида свинца рассчитываем с помощью пропорции:
161,4 г / 331 г = у г / 462 г, отсюда по свойству пропорции имеем: у г • 331 г = 161,4 г • 462 г
у=m(PbI2)=161,4 г • 462 г : 331 г = 225 г
Ответ: m(PbI2)=225 г, n(KI)= 0,98 моль
%USERNAME%, оставишь комментарий?
Имя:*
E-Mail:


В каком классе вы учитесь?